CAS 1261658-14-3

Methyl 5-bromo-2-naphthaleneacetate

Description:

Methyl 5-bromo-2-naphthaleneacetate is an organic compound characterized by its structure, which includes a naphthalene ring substituted with a bromine atom and an ester functional group. This compound features a methyl ester derived from 5-bromo-2-naphthaleneacetic acid. It is typically a solid at room temperature and is known for its aromatic properties due to the presence of the naphthalene moiety. The bromine substitution enhances its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Methyl 5-bromo-2-naphthaleneacetate is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Its solubility characteristics can vary, but it is generally soluble in organic solvents such as dichloromethane and ethyl acetate. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, this compound serves as a valuable intermediate in synthetic organic chemistry.

Formula: C₁₃H₁₁BrO₂

InChI: InChI=1S/C13H11BrO2/c1-16-13(15)8-9-5-6-11-10(7-9)3-2-4-12(11)14/h2-7H,8H2,1H3

InChI key: InChIKey=SPZPIMQDCHPINM-UHFFFAOYSA-N

SMILES: BrC=1C2=C(C=C(CC(OC)=O)C=C2)C=CC1

Synonyms:

• Methyl 5-bromo-2-naphthaleneacetate
• 2-Naphthaleneacetic acid, 5-bromo-, methyl ester