
CAS 126167-34-8
:3H-Imidazo[4,5-c]pyridine-4-carboxylic acid, 4,5,6,7-tetrahydro-, methyl ester, hydrochloride (1:2)
Description:
3H-Imidazo[4,5-c]pyridine-4-carboxylic acid, 4,5,6,7-tetrahydro-, methyl ester, hydrochloride (1:2) is a chemical compound characterized by its imidazole and pyridine ring structures, which contribute to its biological activity and potential pharmacological properties. This compound typically appears as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in medicinal chemistry. The presence of the methyl ester group suggests that it may undergo hydrolysis to release the corresponding carboxylic acid, which can be biologically active. The tetrahydro configuration indicates that the compound has a saturated ring system, which may influence its interaction with biological targets. Its CAS number, 126167-34-8, allows for precise identification in chemical databases. Overall, this compound may exhibit interesting properties for research in drug development, particularly in areas related to neuropharmacology or anti-inflammatory activities, although specific biological activities would require further investigation.
Formula:C8H12ClN3O2
InChI:InChI=1S/C8H11N3O2.2ClH/c1-13-8(12)7-6-5(2-3-9-7)10-4-11-6;;/h4,7,9H,2-3H2,1H3,(H,10,11);2*1H
InChI key:InChIKey=OYBXVUQCSCEIFA-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1C2=C(CCN1)NC=N2.Cl
Synonyms:- 1H-Imidazo[4,5-c]pyridine-4-carboxylic acid, 4,5,6,7-tetrahydro-, methyl ester, dihydrochloride, (±)-
- 1H-Imidazo[4,5-c]pyridine-4-carboxylic acid, 4,5,6,7-tetrahydro-, methyl ester, dihydrochloride
- 3H-Imidazo[4,5-c]pyridine-4-carboxylic acid, 4,5,6,7-tetrahydro-, methyl ester, hydrochloride (1:2)
- methyl 4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-4-carboxylate dihydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.