CAS 1261672-28-9

2-Chloro-α-hydroxy-3-methylbenzeneacetic acid

Description:

2-Chloro-α-hydroxy-3-methylbenzeneacetic acid, with the CAS number 1261672-28-9, is a chemical compound characterized by its aromatic structure and the presence of both a chloro and a hydroxy functional group. This compound features a benzene ring substituted with a methyl group and an acetic acid moiety, which contributes to its acidic properties. The chloro group introduces additional reactivity, potentially influencing its interactions in various chemical environments. The hydroxy group enhances its solubility in polar solvents and can participate in hydrogen bonding, affecting its biological activity and potential applications in pharmaceuticals or agrochemicals. The presence of multiple functional groups suggests that this compound may exhibit interesting properties, such as antimicrobial or anti-inflammatory activities, although specific biological effects would require further investigation. Overall, 2-Chloro-α-hydroxy-3-methylbenzeneacetic acid represents a complex structure with potential utility in various chemical and biological contexts.

Formula: C₉H₉ClO₃

InChI: InChI=1S/C9H9ClO3/c1-5-3-2-4-6(7(5)10)8(11)9(12)13/h2-4,8,11H,1H3,(H,12,13)

InChI key: InChIKey=WPBDGLUWYPOKNX-UHFFFAOYSA-N

SMILES: C(C(O)=O)(O)C1=C(Cl)C(C)=CC=C1

Synonyms:

• 2-Chloro-α-hydroxy-3-methylbenzeneacetic acid
• Benzeneacetic acid, 2-chloro-α-hydroxy-3-methyl-