CAS 1261673-83-9

3-Chloro-2-(trifluoromethoxy)benzonitrile

Description:

3-Chloro-2-(trifluoromethoxy)benzonitrile is an organic compound characterized by its aromatic structure, which includes a chlorinated benzene ring and a nitrile functional group. The presence of the trifluoromethoxy group introduces significant electronegativity, influencing the compound's reactivity and polarity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its polar functional groups. Its chemical properties are influenced by the electron-withdrawing effects of both the chloro and trifluoromethoxy substituents, which can enhance its reactivity in nucleophilic substitution reactions. Additionally, the nitrile group contributes to the compound's potential applications in pharmaceuticals and agrochemicals, as it can serve as a versatile building block in synthetic chemistry. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 3-Chloro-2-(trifluoromethoxy)benzonitrile is a compound of interest in various chemical research fields due to its unique structural features and potential applications.

Formula: C₈H₃ClF₃NO

InChI: InChI=1S/C8H3ClF3NO/c9-6-3-1-2-5(4-13)7(6)14-8(10,11)12/h1-3H

InChI key: InChIKey=JSIYPCQORNHLSJ-UHFFFAOYSA-N

SMILES: O(C(F)(F)F)C1=C(C#N)C=CC=C1Cl

Synonyms:

• 3-Chloro-2-(trifluoromethoxy)benzonitrile
• Benzonitrile, 3-chloro-2-(trifluoromethoxy)-