CAS 1261674-90-1

4-Bromo-2-methoxybenzenepropanal

Description:

4-Bromo-2-methoxybenzenepropanal, with the CAS number 1261674-90-1, is an organic compound characterized by its aromatic structure and functional groups. It features a bromine atom and a methoxy group (-OCH3) attached to a benzene ring, along with a propanal group (-CHO) that contributes to its reactivity and potential applications in organic synthesis. The presence of the bromine atom enhances its electrophilic properties, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions. The methoxy group can influence the compound's solubility and reactivity, often making it more lipophilic. This compound may be utilized in the synthesis of pharmaceuticals, agrochemicals, or other fine chemicals due to its unique structural features. Additionally, its physical properties, such as boiling point and melting point, would be influenced by the molecular interactions of the bromine and methoxy groups, as well as the overall molecular weight. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₀H₁₁BrO₂

InChI: InChI=1S/C10H11BrO2/c1-13-10-7-9(11)5-4-8(10)3-2-6-12/h4-7H,2-3H2,1H3

InChI key: InChIKey=KOSNITVJQQQCET-UHFFFAOYSA-N

SMILES: C(CC=O)C1=C(OC)C=C(Br)C=C1

Synonyms:

• 4-Bromo-2-methoxybenzenepropanal
• Benzenepropanal, 4-bromo-2-methoxy-