CAS 1261676-18-9
:2-Bromo-6-(chloromethyl)benzenamine
Description:
2-Bromo-6-(chloromethyl)benzenamine is an organic compound characterized by the presence of both bromine and chlorine substituents on a benzene ring, along with an amine functional group. The compound features a bromine atom at the 2-position and a chloromethyl group at the 6-position of the benzene ring, which influences its reactivity and potential applications in organic synthesis. The amine group contributes to its basicity and nucleophilicity, making it a useful intermediate in the synthesis of various pharmaceuticals and agrochemicals. The presence of halogens (bromine and chlorine) can enhance the compound's reactivity in electrophilic aromatic substitution reactions. Additionally, the compound's structure suggests potential for hydrogen bonding due to the amine group, which may affect its solubility and interaction with other molecules. Safety considerations should be taken into account when handling this compound, as both brominated and chlorinated compounds can pose health risks. Overall, 2-Bromo-6-(chloromethyl)benzenamine is a versatile compound with significant implications in chemical research and industry.
Formula:C7H7BrClN
InChI:InChI=1S/C7H7BrClN/c8-6-3-1-2-5(4-9)7(6)10/h1-3H,4,10H2
InChI key:InChIKey=KIAQVEMRXBKDHT-UHFFFAOYSA-N
SMILES:C(Cl)C1=C(N)C(Br)=CC=C1
Synonyms:- 2-Bromo-6-(chloromethyl)benzenamine
- Benzenamine, 2-bromo-6-(chloromethyl)-
- 2-Bromo-6-(chloromethyl)aniline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
