
CAS 1261676-27-0
:5-(Difluoromethyl)-2-methoxybenzenamine
Description:
5-(Difluoromethyl)-2-methoxybenzenamine is an organic compound characterized by its aromatic structure, which includes a methoxy group and a difluoromethyl substituent. The presence of the difluoromethyl group introduces unique electronic and steric properties, potentially influencing the compound's reactivity and interactions. The methoxy group, being an electron-donating group, can enhance the nucleophilicity of the amine, making it more reactive in various chemical reactions. This compound is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its hydrophobic aromatic nature. Its chemical properties may include the ability to participate in electrophilic aromatic substitution reactions, as well as potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Safety data should be consulted for handling and storage, as the presence of fluorine atoms can impart specific toxicity and environmental considerations. Overall, 5-(Difluoromethyl)-2-methoxybenzenamine is a compound of interest in both synthetic and applied chemistry contexts.
Formula:C8H9F2NO
InChI:InChI=1S/C8H9F2NO/c1-12-7-3-2-5(8(9)10)4-6(7)11/h2-4,8H,11H2,1H3
InChI key:InChIKey=JAGVLUPDWBUOSA-UHFFFAOYSA-N
SMILES:C(F)(F)C1=CC(N)=C(OC)C=C1
Synonyms:- Benzenamine, 5-(difluoromethyl)-2-methoxy-
- 5-(Difluoromethyl)-2-methoxybenzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.