CymitQuimica logo

CAS 1261676-64-5

:

2-Chloro-1-(2-chloro-4-hydroxyphenyl)-1-propanone

Description:
2-Chloro-1-(2-chloro-4-hydroxyphenyl)-1-propanone is an organic compound characterized by its chlorinated and hydroxylated phenyl group, which contributes to its chemical reactivity and potential applications. This substance features a ketone functional group, indicated by the presence of the carbonyl (C=O) moiety, and two chlorine atoms attached to the aromatic ring, enhancing its electrophilic properties. The hydroxyl group (-OH) on the phenyl ring introduces polarity, which can influence solubility and reactivity in various chemical environments. The compound is likely to exhibit moderate stability under standard conditions but may undergo reactions typical of both ketones and aromatic compounds, such as nucleophilic substitution or electrophilic aromatic substitution. Its unique structure suggests potential utility in pharmaceuticals or agrochemicals, where chlorinated and hydroxylated derivatives are often explored for their biological activity. Safety and handling precautions should be observed due to the presence of chlorine, which can pose health risks. Overall, this compound represents a specific class of chlorinated organic molecules with diverse chemical properties.
Formula:C9H8Cl2O2
InChI:InChI=1S/C9H8Cl2O2/c1-5(10)9(13)7-3-2-6(12)4-8(7)11/h2-5,12H,1H3
InChI key:InChIKey=YAVDWPMMVVBXEU-UHFFFAOYSA-N
SMILES:C(C(C)Cl)(=O)C1=C(Cl)C=C(O)C=C1
Synonyms:
  • 1-Propanone, 2-chloro-1-(2-chloro-4-hydroxyphenyl)-
  • 2-Chloro-1-(2-chloro-4-hydroxyphenyl)-1-propanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.