CymitQuimica logo

CAS 1261677-80-8

:

7-Bromoquinolin-5-ol

Description:
7-Bromoquinolin-5-ol is a chemical compound characterized by its quinoline structure, which features a bromine atom at the 7-position and a hydroxyl group at the 5-position of the quinoline ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the hydroxyl group, which can participate in hydrogen bonding and influence solubility. The bromine substituent may enhance the compound's reactivity and lipophilicity, making it of interest in medicinal chemistry and drug development. 7-Bromoquinolin-5-ol may also exhibit fluorescence, which can be useful in various analytical applications. Its synthesis often involves bromination and subsequent functionalization of quinoline derivatives. As with many brominated compounds, it is essential to consider environmental and safety aspects, as brominated substances can have implications for toxicity and bioaccumulation. Overall, 7-Bromoquinolin-5-ol represents a versatile scaffold for further chemical modifications and potential applications in pharmaceuticals and agrochemicals.
Formula:C9H6NOBr
InChI:InChI=1S/C9H6BrNO/c10-6-4-8-7(9(12)5-6)2-1-3-11-8/h1-5,12H
InChI key:DSLUBMAJPKDQJM-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=C(C=C2O)Br)N=C1
Synonyms:
  • 7-Bromo-5-hydroxyquinoline
Found 4 products.