CymitQuimica logo

CAS 1261678-34-5

:

4-Fluoro-6-quinolinol

Description:
4-Fluoro-6-quinolinol is a chemical compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a fluorine atom at the 4-position and a hydroxyl group at the 6-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to the hydrophobic nature of the quinoline ring. It is often studied for its potential biological activities, including antimicrobial and antitumor properties, owing to the presence of the hydroxyl group that can participate in hydrogen bonding and enhance interactions with biological targets. Additionally, the fluorine substituent can influence the compound's electronic properties and reactivity, making it of interest in medicinal chemistry and drug design. As with many quinoline derivatives, 4-Fluoro-6-quinolinol may also serve as a precursor for the synthesis of more complex molecules in pharmaceutical research. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.
Formula:C9H6FNO
InChI:InChI=1S/C9H6FNO/c10-8-3-4-11-9-2-1-6(12)5-7(8)9/h1-5,12H
InChI key:InChIKey=RMIQSMILUSAULJ-UHFFFAOYSA-N
SMILES:FC=1C2=C(C=CC(O)=C2)N=CC1
Synonyms:
  • 4-Fluoro-6-quinolinol
  • 6-Quinolinol, 4-fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.