
CAS 1261724-62-2
:2-Amino-6-(trifluoromethoxy)benzenemethanamine
Description:
2-Amino-6-(trifluoromethoxy)benzenemethanamine, identified by its CAS number 1261724-62-2, is an organic compound characterized by the presence of an amino group and a trifluoromethoxy substituent on a benzene ring. This compound features a benzene core with a methanamine side chain, which contributes to its basicity and potential reactivity. The trifluoromethoxy group enhances the compound's lipophilicity and may influence its electronic properties, making it of interest in medicinal chemistry and material science. The presence of fluorine atoms typically imparts unique characteristics, such as increased stability and altered solubility profiles. Additionally, the amino group can participate in hydrogen bonding, affecting the compound's interactions in biological systems. Overall, 2-Amino-6-(trifluoromethoxy)benzenemethanamine is a compound that may exhibit significant pharmacological activity, warranting further investigation into its potential applications in drug development and other chemical processes.
Formula:C8H9F3N2O
InChI:InChI=1S/C8H9F3N2O/c9-8(10,11)14-7-3-1-2-6(13)5(7)4-12/h1-3H,4,12-13H2
InChI key:InChIKey=UNUMCDRUJBVDNZ-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=C(CN)C(N)=CC=C1
Synonyms:- 2-Amino-6-(trifluoromethoxy)benzenemethanamine
- Benzenemethanamine, 2-amino-6-(trifluoromethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.