CAS 1261737-52-3

2-Chloro-3-(difluoromethyl)phenol

Description:

2-Chloro-3-(difluoromethyl)phenol is an organic compound characterized by the presence of a phenolic hydroxyl group (-OH) and a chloro substituent on the aromatic ring, along with a difluoromethyl group (-CF2H) at the meta position relative to the hydroxyl group. This compound typically exhibits properties associated with both halogenated and phenolic compounds, such as potential antimicrobial activity and the ability to participate in various chemical reactions due to the reactivity of the chlorine and difluoromethyl groups. Its molecular structure suggests that it may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. The presence of fluorine atoms can enhance lipophilicity and influence the compound's biological activity. Additionally, the compound's solubility, stability, and reactivity can be affected by the specific arrangement of its substituents, making it a subject of interest in both synthetic and medicinal chemistry. Safety data and handling precautions should be considered due to the potential hazards associated with halogenated compounds.

Formula: C₇H₅ClF₂O

InChI: InChI=1S/C7H5ClF2O/c8-6-4(7(9)10)2-1-3-5(6)11/h1-3,7,11H

InChI key: InChIKey=HHWWJZLTIDVLKS-UHFFFAOYSA-N

SMILES: C(F)(F)C1=C(Cl)C(O)=CC=C1

Synonyms:

• 2-Chloro-3-(difluoromethyl)phenol
• Phenol, 2-chloro-3-(difluoromethyl)-