CymitQuimica logo

CAS 1261744-59-5

:

6-Hydroxy-4-quinolinecarbonitrile

Description:
6-Hydroxy-4-quinolinecarbonitrile, identified by its CAS number 1261744-59-5, is a chemical compound that features a quinoline core with a hydroxyl group and a cyano group attached. This compound typically exhibits a pale to dark solid appearance and is characterized by its aromatic structure, which contributes to its stability and potential reactivity. The presence of the hydroxyl group suggests that it may engage in hydrogen bonding, influencing its solubility and interaction with other molecules. The cyano group, known for its electron-withdrawing properties, can enhance the compound's reactivity in various chemical reactions, making it a candidate for applications in pharmaceuticals and organic synthesis. Additionally, compounds of this nature may exhibit biological activity, which could be of interest in medicinal chemistry. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Overall, 6-Hydroxy-4-quinolinecarbonitrile represents a versatile structure with potential applications in various fields of chemistry.
Formula:C10H6N2O
InChI:InChI=1S/C10H6N2O/c11-6-7-3-4-12-10-2-1-8(13)5-9(7)10/h1-5,13H
InChI key:InChIKey=OFZFESPMDBCCMF-UHFFFAOYSA-N
SMILES:C(#N)C=1C2=C(C=CC(O)=C2)N=CC1
Synonyms:
  • 4-Quinolinecarbonitrile, 6-hydroxy-
  • 6-Hydroxy-4-quinolinecarbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.