CymitQuimica logo

CAS 1261752-51-5

:

2-Bromo-3-ethylbenzoic acid

Description:
2-Bromo-3-ethylbenzoic acid is an aromatic carboxylic acid characterized by the presence of a bromine atom and an ethyl group attached to a benzoic acid framework. The bromine substituent is located at the second position, while the ethyl group is at the third position relative to the carboxylic acid functional group. This compound typically exhibits moderate solubility in organic solvents and limited solubility in water due to its hydrophobic aromatic structure. The presence of the bromine atom can influence its reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitution and nucleophilic reactions. Additionally, the ethyl group can affect the steric and electronic properties of the molecule, potentially enhancing its reactivity or altering its interaction with biological systems. As with many brominated compounds, 2-Bromo-3-ethylbenzoic acid may exhibit unique properties that could be of interest in fields such as medicinal chemistry, materials science, and organic synthesis. Safety precautions should be taken when handling this compound due to the potential hazards associated with brominated substances.
Formula:C9H9BrO2
InChI:InChI=1S/C9H9BrO2/c1-2-6-4-3-5-7(8(6)10)9(11)12/h3-5H,2H2,1H3,(H,11,12)
InChI key:InChIKey=BDGLBLFVPSXIQH-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(Br)C(CC)=CC=C1
Synonyms:
  • Benzoic acid, 2-bromo-3-ethyl-
  • 2-Bromo-3-ethylbenzoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.