CAS 1261753-80-3

Naphthalene, 2-bromo-1-(trifluoromethoxy)-

Description:

Naphthalene, 2-bromo-1-(trifluoromethoxy)- is an organic compound characterized by its naphthalene backbone, which consists of two fused benzene rings. The presence of a bromine atom at the 2-position and a trifluoromethoxy group at the 1-position significantly influences its chemical properties. This compound is likely to exhibit moderate to high lipophilicity due to the naphthalene structure, while the trifluoromethoxy group introduces notable electronegativity and potential for strong intermolecular interactions. It may also display reactivity typical of halogenated compounds, such as undergoing nucleophilic substitution or electrophilic aromatic substitution reactions. The trifluoromethoxy group can enhance the compound's stability and alter its solubility in various solvents. Additionally, due to the presence of bromine, it may have applications in organic synthesis or as an intermediate in the production of other chemical entities. Safety data should be consulted for handling, as halogenated compounds can pose health and environmental risks.

Formula: C₁₁H₆BrF₃O

InChI: InChI=1S/C11H6BrF3O/c12-9-6-5-7-3-1-2-4-8(7)10(9)16-11(13,14)15/h1-6H

InChI key: InChIKey=VKUQEOMWHZFLRC-UHFFFAOYSA-N

SMILES: O(C(F)(F)F)C=1C2=C(C=CC1Br)C=CC=C2

Synonyms:

• Naphthalene, 2-bromo-1-(trifluoromethoxy)-
• 2-Bromo-1-(trifluoromethoxy)naphthalene