CAS 1261761-30-1

2-(Difluoromethyl)-3-methylphenol

Description:

2-(Difluoromethyl)-3-methylphenol, identified by its CAS number 1261761-30-1, is an organic compound characterized by the presence of a phenolic structure with a methyl group and a difluoromethyl substituent. This compound typically exhibits properties associated with both aromatic compounds and alcohols, including potential solubility in organic solvents and moderate polarity due to the hydroxyl (-OH) group. The difluoromethyl group introduces unique reactivity and influences the compound's electronic properties, potentially enhancing its biological activity or chemical stability. The presence of fluorine atoms can also affect the compound's lipophilicity and volatility. As a phenolic compound, it may exhibit antioxidant properties and could be of interest in various applications, including pharmaceuticals, agrochemicals, or materials science. However, specific physical and chemical properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization. Safety and handling considerations should also be taken into account due to the potential toxicity associated with fluorinated compounds.

Formula: C₈H₈F₂O

InChI: InChI=1S/C8H8F2O/c1-5-3-2-4-6(11)7(5)8(9)10/h2-4,8,11H,1H3

InChI key: InChIKey=UWKDVFFINUIQOI-UHFFFAOYSA-N

SMILES: C(F)(F)C1=C(C)C=CC=C1O

Synonyms:

• Phenol, 2-(difluoromethyl)-3-methyl-
• 2-(Difluoromethyl)-3-methylphenol