CAS 1261770-91-5

2-(Difluoromethyl)-3-quinolinol

Description:

2-(Difluoromethyl)-3-quinolinol is a chemical compound characterized by its unique structure, which includes a quinoline ring system substituted with a difluoromethyl group and a hydroxyl group. The presence of the difluoromethyl group imparts distinctive electronic and steric properties, potentially influencing the compound's reactivity and biological activity. The hydroxyl group contributes to its polarity, enhancing solubility in polar solvents and possibly affecting its interaction with biological targets. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in the design of compounds targeting specific biological pathways. Additionally, the presence of fluorine atoms can enhance metabolic stability and bioavailability. As with many quinoline derivatives, 2-(Difluoromethyl)-3-quinolinol may also exhibit antimicrobial or antitumor activities, although specific biological data would be necessary to confirm these properties. Overall, this compound represents a valuable scaffold for further research in various chemical and pharmaceutical applications.

Formula: C₁₀H₇F₂NO

InChI: InChI=1S/C10H7F2NO/c11-10(12)9-8(14)5-6-3-1-2-4-7(6)13-9/h1-5,10,14H

InChI key: InChIKey=DCCORTUTWSIJPN-UHFFFAOYSA-N

SMILES: C(F)(F)C1=NC2=C(C=C1O)C=CC=C2

Synonyms:

• 3-Quinolinol, 2-(difluoromethyl)-
• 2-(Difluoromethyl)-3-quinolinol