CAS 1261775-62-5

2-Bromo-6-cyanobenzenesulfonamide

Description:

2-Bromo-6-cyanobenzenesulfonamide is an organic compound characterized by the presence of a bromine atom, a cyano group, and a sulfonamide functional group attached to a benzene ring. This compound features a sulfonamide group (-SO2NH2), which is known for its ability to form hydrogen bonds and its role in medicinal chemistry, particularly in the development of pharmaceuticals. The bromine substituent introduces a halogen, which can influence the compound's reactivity and solubility, while the cyano group (-C≡N) contributes to its electronic properties and potential applications in organic synthesis. The presence of these functional groups suggests that 2-Bromo-6-cyanobenzenesulfonamide may exhibit interesting biological activities, making it a candidate for further research in drug development. Additionally, its molecular structure may impart specific physical properties, such as melting point and solubility in various solvents, which are important for its practical applications in laboratory and industrial settings. Overall, this compound represents a versatile structure with potential utility in various chemical and pharmaceutical contexts.

Formula: C₇H₅BrN₂O₂S

InChI: InChI=1S/C7H5BrN2O2S/c8-6-3-1-2-5(4-9)7(6)13(10,11)12/h1-3H,(H2,10,11,12)

InChI key: InChIKey=AOJSEAOSDKOHHL-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C1=C(C#N)C=CC=C1Br

Synonyms:

• Benzenesulfonamide, 2-bromo-6-cyano-
• 2-Bromo-6-cyanobenzenesulfonamide