
CAS 1261775-65-8
:3-Bromo-5-(chloromethyl)benzonitrile
Description:
3-Bromo-5-(chloromethyl)benzonitrile is an organic compound characterized by its aromatic structure, which includes a bromine atom and a chloromethyl group attached to a benzonitrile framework. The presence of the bromine and chloromethyl substituents contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound features a nitrile functional group, which is known for its ability to participate in various chemical reactions, including nucleophilic additions and cycloadditions. The molecular structure suggests that it may exhibit polar characteristics due to the electronegative halogen atoms, influencing its solubility and interaction with other chemical species. Additionally, the compound's unique substituents may impart specific biological activities, making it of interest in pharmaceutical research. Safety and handling precautions are essential due to the presence of halogens, which can pose health risks. Overall, 3-Bromo-5-(chloromethyl)benzonitrile is a versatile compound with potential applications in various fields of chemistry.
Formula:C8H5BrClN
InChI:InChI=1S/C8H5BrClN/c9-8-2-6(4-10)1-7(3-8)5-11/h1-3H,4H2
InChI key:InChIKey=UOBQSESRRRXZHQ-UHFFFAOYSA-N
SMILES:C(Cl)C1=CC(C#N)=CC(Br)=C1
Synonyms:- 3-Bromo-5-(chloromethyl)benzonitrile
- Benzonitrile, 3-bromo-5-(chloromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.