
CAS 1261775-92-1
:1-(2-Bromo-3-fluorophenyl)-1-propanone
Description:
1-(2-Bromo-3-fluorophenyl)-1-propanone, identified by its CAS number 1261775-92-1, is an organic compound characterized by its unique functional groups and molecular structure. It features a propanone moiety, which is a ketone, indicating the presence of a carbonyl group (C=O) adjacent to a propyl group. The compound also contains a phenyl ring substituted with both bromine and fluorine atoms, which significantly influence its chemical reactivity and physical properties. The presence of these halogens can enhance the compound's electrophilicity and may affect its solubility in various solvents. Additionally, the bromine and fluorine substituents can impart specific electronic effects, making the compound of interest in medicinal chemistry and material science. Its synthesis and reactivity may be explored in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a valuable intermediate in organic synthesis. Overall, this compound exemplifies the complexity and versatility of halogenated organic molecules in chemical research and applications.
Formula:C9H8BrFO
InChI:InChI=1S/C9H8BrFO/c1-2-8(12)6-4-3-5-7(11)9(6)10/h3-5H,2H2,1H3
InChI key:InChIKey=FYLJUZRUBKUSPC-UHFFFAOYSA-N
SMILES:C(CC)(=O)C1=C(Br)C(F)=CC=C1
Synonyms:- 1-(2-Bromo-3-fluorophenyl)-1-propanone
- 1-Propanone, 1-(2-bromo-3-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.