CAS 1261776-00-4

2-Bromo-6-hydroxybenzenepropanoic acid

Description:

2-Bromo-6-hydroxybenzenepropanoic acid, identified by its CAS number 1261776-00-4, is an organic compound characterized by the presence of a bromine atom, a hydroxyl group, and a propanoic acid moiety attached to a benzene ring. This compound features a bromine substituent at the second position and a hydroxyl group at the sixth position of the benzene ring, which contributes to its reactivity and potential biological activity. The propanoic acid functional group imparts acidic properties, making it soluble in polar solvents. The presence of both the hydroxyl and carboxylic acid groups suggests that it may participate in hydrogen bonding, influencing its solubility and interaction with other molecules. Additionally, the bromine atom can enhance the compound's electrophilic character, making it a potential candidate for further chemical reactions or applications in pharmaceuticals and agrochemicals. Overall, 2-Bromo-6-hydroxybenzenepropanoic acid exhibits a unique combination of functional groups that may confer specific chemical and biological properties.

Formula: C₉H₉BrO₃

InChI: InChI=1S/C9H9BrO3/c10-7-2-1-3-8(11)6(7)4-5-9(12)13/h1-3,11H,4-5H2,(H,12,13)

InChI key: InChIKey=CMKKULCGIWQHBR-UHFFFAOYSA-N

SMILES: C(CC(O)=O)C1=C(Br)C=CC=C1O

Synonyms:

• 2-Bromo-6-hydroxybenzenepropanoic acid
• Benzenepropanoic acid, 2-bromo-6-hydroxy-