CAS 1261776-24-2

1-(2-Bromo-5-iodophenyl)-1-propanone

Description:

1-(2-Bromo-5-iodophenyl)-1-propanone is an organic compound characterized by its unique structure, which includes a propanone moiety attached to a phenyl ring that is substituted with both bromine and iodine atoms. This compound typically exhibits properties associated with halogenated aromatic compounds, such as increased reactivity due to the presence of the electronegative halogens. The bromine and iodine substituents can influence the compound's physical properties, including its solubility and boiling point, as well as its reactivity in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The presence of the carbonyl group (ketone) in the propanone structure also contributes to its reactivity, making it a potential intermediate in organic synthesis. Additionally, the compound may exhibit specific biological activities, which could be of interest in medicinal chemistry. Overall, 1-(2-Bromo-5-iodophenyl)-1-propanone is a versatile compound with applications in research and synthesis, particularly in the fields of organic and medicinal chemistry.

Formula: C₉H₈BrIO

InChI: InChI=1S/C9H8BrIO/c1-2-9(12)7-5-6(11)3-4-8(7)10/h3-5H,2H2,1H3

InChI key: InChIKey=PQUHTJPEYPTWIY-UHFFFAOYSA-N

SMILES: C(CC)(=O)C1=C(Br)C=CC(I)=C1

Synonyms:

• 1-Propanone, 1-(2-bromo-5-iodophenyl)-
• 1-(2-Bromo-5-iodophenyl)-1-propanone