CymitQuimica logo

CAS 1261776-25-3

:

5-(Difluoromethoxy)-2-fluorobenzamide

Description:
5-(Difluoromethoxy)-2-fluorobenzamide is a chemical compound characterized by its unique structure, which includes a benzamide moiety substituted with both difluoromethoxy and fluorine groups. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions. The presence of fluorine atoms often enhances lipophilicity and can influence the compound's biological activity, making it of interest in pharmaceutical research. The difluoromethoxy group may also impart specific electronic properties, affecting the compound's reactivity and interaction with biological targets. Additionally, the compound's solubility, melting point, and boiling point can vary based on its molecular interactions and the presence of functional groups. Overall, 5-(Difluoromethoxy)-2-fluorobenzamide is a fluorinated aromatic compound that may have applications in medicinal chemistry, particularly in the development of new therapeutic agents. Its precise characteristics, including spectral data and reactivity, would typically be determined through experimental methods and detailed analysis.
Formula:C8H6F3NO2
InChI:InChI=1S/C8H6F3NO2/c9-6-2-1-4(14-8(10)11)3-5(6)7(12)13/h1-3,8H,(H2,12,13)
InChI key:InChIKey=JUKTTWKOBFGLJT-UHFFFAOYSA-N
SMILES:O(C(F)F)C1=CC(C(N)=O)=C(F)C=C1
Synonyms:
  • 5-(Difluoromethoxy)-2-fluorobenzamide
  • Benzamide, 5-(difluoromethoxy)-2-fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.