CymitQuimica logo

CAS 1261783-56-5

:

(4-Bromo-3-chlorophenyl)-4-pyridinylmethanone

Description:
(4-Bromo-3-chlorophenyl)-4-pyridinylmethanone is a chemical compound characterized by its complex structure, which includes a phenyl ring substituted with bromine and chlorine atoms, as well as a pyridine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of halogen substituents that can influence reactivity and solubility. The presence of the carbonyl group (ketone) in the structure contributes to its reactivity, making it a candidate for various chemical reactions, such as nucleophilic attacks. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as halogenated compounds often exhibit enhanced biological properties. Additionally, the compound's stability and solubility characteristics can vary based on the solvent and environmental conditions, which are important for its practical applications. Overall, (4-Bromo-3-chlorophenyl)-4-pyridinylmethanone is a noteworthy compound in the realm of organic synthesis and drug development.
Formula:C12H7BrClNO
InChI:InChI=1S/C12H7BrClNO/c13-10-2-1-9(7-11(10)14)12(16)8-3-5-15-6-4-8/h1-7H
InChI key:InChIKey=IKYYIHKJFWHEGW-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(Cl)=C(Br)C=C1)C=2C=CN=CC2
Synonyms:
  • Methanone, (4-bromo-3-chlorophenyl)-4-pyridinyl-
  • (4-Bromo-3-chlorophenyl)-4-pyridinylmethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.