CAS 1261794-09-5

3-Bromo-2-methoxybenzenesulfonyl chloride

Description:

3-Bromo-2-methoxybenzenesulfonyl chloride, with the CAS number 1261794-09-5, is an organic compound characterized by the presence of a bromine atom, a methoxy group, and a sulfonyl chloride functional group attached to a benzene ring. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its reactivity due to the sulfonyl chloride moiety, which can participate in nucleophilic substitution reactions. The bromine substituent can also serve as a site for further functionalization, making it useful in synthetic organic chemistry. The methoxy group contributes to the compound's overall polarity and can influence its solubility in various solvents. Additionally, this compound is often handled with care due to its potential to release hydrochloric acid upon hydrolysis, which can pose safety hazards. Overall, 3-Bromo-2-methoxybenzenesulfonyl chloride is a valuable intermediate in the synthesis of more complex organic molecules, particularly in pharmaceutical and agrochemical applications.

Formula: C₇H₆BrClO₃S

InChI: InChI=1S/C7H6BrClO3S/c1-12-7-5(8)3-2-4-6(7)13(9,10)11/h2-4H,1H3

InChI key: InChIKey=JMNPYNBAUDBKPV-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C1=C(OC)C(Br)=CC=C1

Synonyms:

• 3-Bromo-2-methoxybenzenesulfonyl chloride
• Benzenesulfonyl chloride, 3-bromo-2-methoxy-