
CAS 1261794-20-0
:Benzene, 2-bromo-1-(chloromethyl)-3-methoxy-
Description:
Benzene, 2-bromo-1-(chloromethyl)-3-methoxy- is an organic compound characterized by a benzene ring substituted with a bromine atom, a chloromethyl group, and a methoxy group. The presence of these substituents influences its chemical reactivity and physical properties. The bromine atom typically enhances the compound's electrophilic character, making it more reactive in nucleophilic substitution reactions. The chloromethyl group can serve as a leaving group in various chemical transformations, while the methoxy group is known for its electron-donating properties, which can stabilize the aromatic system. This compound may exhibit moderate solubility in organic solvents and is likely to be less soluble in water due to its hydrophobic benzene structure. Its applications may include use in organic synthesis, pharmaceuticals, or as an intermediate in the production of other chemical compounds. Safety considerations should be taken into account, as halogenated compounds can pose health risks and environmental concerns.
Formula:C8H8BrClO
InChI:InChI=1S/C8H8BrClO/c1-11-7-4-2-3-6(5-10)8(7)9/h2-4H,5H2,1H3
InChI key:InChIKey=IFSJWURUKCFKDK-UHFFFAOYSA-N
SMILES:C(Cl)C1=C(Br)C(OC)=CC=C1
Synonyms:- Benzene, 2-bromo-1-(chloromethyl)-3-methoxy-
- 2-Bromo-1-(chloromethyl)-3-methoxybenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.