CAS 1261794-86-8

3-Bromo-4-nitrobenzamide

Description:

3-Bromo-4-nitrobenzamide is an organic compound characterized by the presence of a bromine atom and a nitro group attached to a benzene ring, which is further substituted with an amide functional group. This compound typically appears as a solid at room temperature and is soluble in organic solvents. The bromine atom introduces a halogen, which can influence the compound's reactivity and stability, while the nitro group is known for its electron-withdrawing properties, affecting the compound's electronic characteristics. The amide group contributes to the compound's ability to participate in hydrogen bonding, which can impact its solubility and boiling point. 3-Bromo-4-nitrobenzamide may be utilized in various chemical syntheses and research applications, particularly in the fields of medicinal chemistry and materials science. Its specific reactivity and interactions can be influenced by the presence of the bromine and nitro substituents, making it a compound of interest for further study in organic synthesis and potential pharmaceutical applications.

Formula: C₇H₅BrN₂O₃

InChI: InChI=1S/C7H5BrN2O3/c8-5-3-4(7(9)11)1-2-6(5)10(12)13/h1-3H,(H2,9,11)

InChI key: InChIKey=WASHERDYVKIIBK-UHFFFAOYSA-N

SMILES: C(N)(=O)C1=CC(Br)=C(N(=O)=O)C=C1

Synonyms:

• Benzamide, 3-bromo-4-nitro-
• 3-Bromo-4-nitrobenzamide