CAS 1261808-46-1

5-Chloro-2-(difluoromethoxy)pyrimidine

Description:

5-Chloro-2-(difluoromethoxy)pyrimidine is a heterocyclic organic compound characterized by its pyrimidine ring structure, which contains nitrogen atoms in the 1 and 3 positions. The presence of a chlorine atom at the 5-position and a difluoromethoxy group at the 2-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow solid and is soluble in organic solvents. Its molecular structure suggests potential reactivity due to the electronegative chlorine and fluorine atoms, which can influence its behavior in chemical reactions, particularly in nucleophilic substitutions or as a building block in pharmaceutical synthesis. The difluoromethoxy group may enhance its lipophilicity and biological activity, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the presence of the halogen substituents, which can affect its interaction with biological targets. Overall, 5-Chloro-2-(difluoromethoxy)pyrimidine is a compound of interest for research and development in various chemical and pharmaceutical applications.

Formula: C₅H₃ClF₂N₂O

InChI: InChI=1S/C5H3ClF2N2O/c6-3-1-9-5(10-2-3)11-4(7)8/h1-2,4H

InChI key: InChIKey=ITXMDDWROTYREF-UHFFFAOYSA-N

SMILES: O(C(F)F)C=1N=CC(Cl)=CN1

Synonyms:

• Pyrimidine, 5-chloro-2-(difluoromethoxy)-
• 5-Chloro-2-(difluoromethoxy)pyrimidine