CAS 1261811-68-0

4-Chloro-6-methyl-3-pyridinol

Description:

4-Chloro-6-methyl-3-pyridinol is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a chlorine atom and a methyl group attached to the pyridine ring, specifically at the 4 and 6 positions, respectively, while the hydroxyl group is located at the 3 position. The presence of these functional groups contributes to its unique chemical properties, including its potential as a building block in organic synthesis and its applications in pharmaceuticals or agrochemicals. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the hydroxyl group. Its reactivity can be influenced by the electron-withdrawing nature of the chlorine atom and the electron-donating nature of the methyl group, which can affect its behavior in various chemical reactions. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₆H₆ClNO

InChI: InChI=1S/C6H6ClNO/c1-4-2-5(7)6(9)3-8-4/h2-3,9H,1H3

InChI key: InChIKey=FHXPRNBMGUMEFL-UHFFFAOYSA-N

SMILES: ClC=1C(O)=CN=C(C)C1

Synonyms:

• 4-Chloro-6-methyl-3-pyridinol
• 3-Pyridinol, 4-chloro-6-methyl-