CymitQuimica logo

CAS 1261825-33-5

:

3,6-Difluoro-2-hydroxybenzenesulfonyl chloride

Description:
3,6-Difluoro-2-hydroxybenzenesulfonyl chloride is an organic compound characterized by the presence of a sulfonyl chloride functional group attached to a benzene ring that is further substituted with two fluorine atoms and a hydroxyl group. This compound typically appears as a solid or liquid, depending on temperature and purity, and is known for its reactivity due to the sulfonyl chloride moiety, which can participate in nucleophilic substitution reactions. The fluorine substituents enhance the compound's electrophilicity and may influence its solubility and stability in various solvents. The hydroxyl group contributes to its potential as a versatile intermediate in organic synthesis, particularly in the preparation of sulfonamides and other functionalized aromatic compounds. Additionally, the presence of fluorine atoms can impart unique properties such as increased lipophilicity and altered biological activity, making this compound of interest in medicinal chemistry and materials science. Proper handling and storage are essential due to its reactive nature and potential hazards associated with sulfonyl chlorides.
Formula:C6H3ClF2O3S
InChI:InChI=1S/C6H3ClF2O3S/c7-13(11,12)6-4(9)2-1-3(8)5(6)10/h1-2,10H
InChI key:InChIKey=LGQBWHWCNMNFRS-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C1=C(O)C(F)=CC=C1F
Synonyms:
  • Benzenesulfonyl chloride, 3,6-difluoro-2-hydroxy-
  • 3,6-Difluoro-2-hydroxybenzenesulfonyl chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.