
CAS 1261825-63-1
:2,5-Difluoro-α-hydroxy-4-methoxybenzeneacetic acid
Description:
2,5-Difluoro-α-hydroxy-4-methoxybenzeneacetic acid is a chemical compound characterized by its unique molecular structure, which includes a benzene ring substituted with two fluorine atoms, a methoxy group, and an α-hydroxy group. This compound is likely to exhibit properties typical of aromatic acids, including moderate solubility in polar solvents due to the presence of the hydroxyl and methoxy groups. The fluorine substituents can influence the compound's reactivity and polarity, potentially enhancing its biological activity or altering its interaction with other molecules. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions and may form salts or esters. Additionally, the compound's structural features may contribute to its potential applications in pharmaceuticals or agrochemicals, where fluorinated compounds are often valued for their enhanced metabolic stability and bioactivity. Overall, 2,5-Difluoro-α-hydroxy-4-methoxybenzeneacetic acid represents a complex molecule with interesting chemical properties and potential utility in various fields.
Formula:C9H8F2O4
InChI:InChI=1S/C9H8F2O4/c1-15-7-3-5(10)4(2-6(7)11)8(12)9(13)14/h2-3,8,12H,1H3,(H,13,14)
InChI key:InChIKey=MOCXOIFNMQVTQA-UHFFFAOYSA-N
SMILES:C(C(O)=O)(O)C1=C(F)C=C(OC)C(F)=C1
Synonyms:- 2,5-Difluoro-α-hydroxy-4-methoxybenzeneacetic acid
- Benzeneacetic acid, 2,5-difluoro-α-hydroxy-4-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.