CymitQuimica logo

CAS 1261827-20-6

:

1-(Chloromethyl)-3-iodo-5-(trifluoromethyl)benzene

Description:
1-(Chloromethyl)-3-iodo-5-(trifluoromethyl)benzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a chloromethyl group, an iodine atom, and a trifluoromethyl group. The presence of these substituents significantly influences its chemical properties and reactivity. The chloromethyl group can participate in nucleophilic substitution reactions, while the iodine atom can serve as a leaving group in various chemical transformations. The trifluoromethyl group is known for its electron-withdrawing properties, which can enhance the compound's reactivity in electrophilic aromatic substitution reactions. This compound is likely to be a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique combination of halogen substituents makes it of interest in medicinal chemistry and materials science, where it may serve as a precursor for the synthesis of more complex molecules or as a building block in the development of pharmaceuticals. Safety precautions should be taken when handling this compound due to the presence of halogens, which can pose health and environmental risks.
Formula:C8H5ClF3I
InChI:InChI=1S/C8H5ClF3I/c9-4-5-1-6(8(10,11)12)3-7(13)2-5/h1-3H,4H2
InChI key:InChIKey=HAVQHJWIZDFUMS-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(CCl)=CC(I)=C1
Synonyms:
  • Benzene, 1-(chloromethyl)-3-iodo-5-(trifluoromethyl)-
  • 1-(Chloromethyl)-3-iodo-5-(trifluoromethyl)benzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.