CAS 1261827-86-4

2-Methoxy-3-nitrobenzenesulfonamide

Description:

2-Methoxy-3-nitrobenzenesulfonamide is an organic compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a methoxy group (-OCH3) and a nitro group (-NO2) attached to a benzene ring, contributing to its chemical reactivity and potential biological activity. The presence of the sulfonamide group enhances its solubility in polar solvents, making it useful in various chemical applications. The nitro group can participate in electrophilic substitution reactions, while the methoxy group can influence the electronic properties of the benzene ring, affecting its reactivity. This compound may be of interest in medicinal chemistry due to its structural features, which could lead to the development of new pharmaceuticals. Additionally, its unique combination of functional groups may impart specific properties, such as antimicrobial activity or the ability to act as a ligand in coordination chemistry. Overall, 2-Methoxy-3-nitrobenzenesulfonamide represents a versatile structure with potential applications in both research and industry.

Formula: C₇H₈N₂O₅S

InChI: InChI=1S/C7H8N2O5S/c1-14-7-5(9(10)11)3-2-4-6(7)15(8,12)13/h2-4H,1H3,(H2,8,12,13)

InChI key: InChIKey=KRGIODSUNGRRSE-UHFFFAOYSA-N

SMILES: O(C)C1=C(S(N)(=O)=O)C=CC=C1N(=O)=O

Synonyms:

• 2-Methoxy-3-nitrobenzenesulfonamide
• Benzenesulfonamide, 2-methoxy-3-nitro-