CAS 1261828-14-1

5′-(Bromomethyl)-2,2′,3-trifluoro-1,1′-biphenyl

Description:

5′-(Bromomethyl)-2,2′,3-trifluoro-1,1′-biphenyl is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of bromomethyl and trifluoro groups significantly influences its chemical properties. The bromomethyl group introduces a reactive site, making it useful in various synthetic applications, including as an intermediate in organic synthesis. The trifluoro groups enhance the compound's lipophilicity and stability, which can affect its reactivity and interactions with biological systems. This compound is likely to exhibit unique physical properties, such as altered melting and boiling points compared to its non-fluorinated counterparts, due to the strong electronegative influence of the fluorine atoms. Additionally, the presence of multiple halogen atoms may impart specific characteristics, such as increased resistance to degradation and potential applications in materials science or pharmaceuticals. Overall, this compound's unique structure and functional groups make it a subject of interest in both synthetic organic chemistry and materials research.

Formula: C₁₃H₈BrF₃

InChI: InChI=1S/C13H8BrF3/c14-7-8-4-5-11(15)10(6-8)9-2-1-3-12(16)13(9)17/h1-6H,7H2

InChI key: InChIKey=YWRAVDUPLNCSIN-UHFFFAOYSA-N

SMILES: FC=1C(=CC(CBr)=CC1)C2=C(F)C(F)=CC=C2

Synonyms:

• 1,1′-Biphenyl, 5′-(bromomethyl)-2,2′,3-trifluoro-
• 5′-(Bromomethyl)-2,2′,3-trifluoro-1,1′-biphenyl