CymitQuimica logo

CAS 1261836-76-3

:

3-Fluoro-3′-(trifluoromethoxy)[1,1′-biphenyl]-4-methanamine

Description:
3-Fluoro-3′-(trifluoromethoxy)[1,1′-biphenyl]-4-methanamine is a chemical compound characterized by its complex structure, which includes a biphenyl framework substituted with a fluorine atom and a trifluoromethoxy group. The presence of the trifluoromethoxy group significantly influences its chemical properties, enhancing its lipophilicity and potentially affecting its reactivity and biological activity. The amine functional group contributes to its basicity and potential for hydrogen bonding, making it a candidate for various applications in medicinal chemistry and material science. This compound may exhibit interesting pharmacological properties due to its unique electronic and steric characteristics, which can affect its interaction with biological targets. Additionally, the presence of multiple fluorine atoms can enhance metabolic stability and alter the compound's solubility profile. Overall, 3-Fluoro-3′-(trifluoromethoxy)[1,1′-biphenyl]-4-methanamine represents a class of fluorinated organic compounds that are of interest in both research and industrial applications.
Formula:C14H11F4NO
InChI:InChI=1S/C14H11F4NO/c15-13-7-10(4-5-11(13)8-19)9-2-1-3-12(6-9)20-14(16,17)18/h1-7H,8,19H2
InChI key:InChIKey=VTGINAKZERMWIF-UHFFFAOYSA-N
SMILES:FC=1C=C(C=CC1CN)C2=CC(OC(F)(F)F)=CC=C2
Synonyms:
  • 3-Fluoro-3′-(trifluoromethoxy)[1,1′-biphenyl]-4-methanamine
  • [1,1′-Biphenyl]-4-methanamine, 3-fluoro-3′-(trifluoromethoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.