CAS 1261850-05-8

3-(2,4,5-Trichlorophenyl)-2-pyridinamine

Description:

3-(2,4,5-Trichlorophenyl)-2-pyridinamine, identified by its CAS number 1261850-05-8, is a chemical compound characterized by its unique structure, which includes a pyridinamine moiety and a trichlorophenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the amine group and the electron-withdrawing effects of the chlorinated phenyl ring. The trichlorophenyl substituent can influence the compound's solubility, stability, and reactivity, making it of interest in various fields, including medicinal chemistry and agrochemicals. Its synthesis and application may involve considerations of environmental impact and safety due to the presence of chlorine atoms, which can impart toxicity and persistence in the environment. Overall, 3-(2,4,5-Trichlorophenyl)-2-pyridinamine represents a complex chemical entity with potential utility in research and development, particularly in the context of drug discovery or as a biochemical probe.

Formula: C₁₁H₇Cl₃N₂

InChI: InChI=1S/C11H7Cl3N2/c12-8-5-10(14)9(13)4-7(8)6-2-1-3-16-11(6)15/h1-5H,(H2,15,16)

InChI key: InChIKey=OEEXIZKBFKTFPA-UHFFFAOYSA-N

SMILES: ClC1=C(C=C(Cl)C(Cl)=C1)C2=C(N)N=CC=C2

Synonyms:

• 2-Pyridinamine, 3-(2,4,5-trichlorophenyl)-
• 3-(2,4,5-Trichlorophenyl)-2-pyridinamine