CymitQuimica logo

CAS 1261852-64-5

:

5-Methyl-2-(trifluoromethoxy)benzenemethanol

Description:
5-Methyl-2-(trifluoromethoxy)benzenemethanol is an organic compound characterized by its aromatic structure, which includes a methyl group and a trifluoromethoxy substituent on a benzene ring. The presence of the trifluoromethoxy group imparts unique electronic properties, making the compound potentially useful in various chemical applications, including pharmaceuticals and agrochemicals. The hydroxymethyl group (-CH2OH) contributes to its reactivity, allowing for potential hydrogen bonding and interactions with other molecules. This compound is likely to be a solid or liquid at room temperature, depending on its molecular weight and structure. Its trifluoromethyl group enhances lipophilicity, which can influence its solubility in organic solvents. Additionally, the presence of fluorine atoms typically increases the compound's stability and resistance to degradation. Overall, 5-Methyl-2-(trifluoromethoxy)benzenemethanol exhibits a combination of hydrophilic and lipophilic characteristics, making it a compound of interest in various fields of research and industry.
Formula:C9H9F3O2
InChI:InChI=1S/C9H9F3O2/c1-6-2-3-8(7(4-6)5-13)14-9(10,11)12/h2-4,13H,5H2,1H3
InChI key:InChIKey=NRDALTWSSLVMLU-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=C(CO)C=C(C)C=C1
Synonyms:
  • Benzenemethanol, 5-methyl-2-(trifluoromethoxy)-
  • 5-Methyl-2-(trifluoromethoxy)benzenemethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.