CymitQuimica logo

CAS 1261855-31-5

:

Methyl 6-hydroxy-4′-(trifluoromethoxy)[1,1′-biphenyl]-3-carboxylate

Description:
Methyl 6-hydroxy-4′-(trifluoromethoxy)[1,1′-biphenyl]-3-carboxylate, identified by its CAS number 1261855-31-5, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a carboxylate functional group, which contributes to its acidity and reactivity, and a hydroxyl group that can participate in hydrogen bonding, enhancing its solubility in polar solvents. The presence of a trifluoromethoxy group introduces significant electronegativity, influencing the compound's electronic properties and potentially enhancing its biological activity. Methyl esters, like this compound, are often used in various chemical syntheses and can serve as intermediates in the production of pharmaceuticals or agrochemicals. The trifluoromethoxy group may also impart unique characteristics such as increased lipophilicity and altered metabolic stability. Overall, this compound's structural features suggest potential applications in medicinal chemistry and materials science, although specific biological activities and reactivity would require further investigation.
Formula:C15H11F3O4
InChI:InChI=1S/C15H11F3O4/c1-21-14(20)10-4-7-13(19)12(8-10)9-2-5-11(6-3-9)22-15(16,17)18/h2-8,19H,1H3
InChI key:InChIKey=WEWOMEQTUMFRDZ-UHFFFAOYSA-N
SMILES:OC=1C(=CC(C(OC)=O)=CC1)C2=CC=C(OC(F)(F)F)C=C2
Synonyms:
  • Methyl 6-hydroxy-4′-(trifluoromethoxy)[1,1′-biphenyl]-3-carboxylate
  • [1,1′-Biphenyl]-3-carboxylic acid, 6-hydroxy-4′-(trifluoromethoxy)-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.