CAS 1261861-05-5

4-Chloro-3-iodobenzenesulfonamide

Description:

4-Chloro-3-iodobenzenesulfonamide is an organic compound characterized by the presence of a sulfonamide functional group attached to a benzene ring that is substituted with both chlorine and iodine atoms. The compound features a chloro group at the para position and an iodo group at the meta position relative to the sulfonamide group. This structural arrangement contributes to its unique chemical properties, including its potential reactivity and solubility characteristics. The presence of halogens (chlorine and iodine) can influence the compound's electronic properties, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, sulfonamides are known for their biological activity, often exhibiting antibacterial properties. The compound's molecular weight, melting point, and solubility in different solvents can vary, depending on the specific conditions and purity. As with many halogenated compounds, safety precautions should be taken when handling 4-Chloro-3-iodobenzenesulfonamide due to potential toxicity and environmental impact.

Formula: C₆H₅ClINO₂S

InChI: InChI=1S/C6H5ClINO2S/c7-5-2-1-4(3-6(5)8)12(9,10)11/h1-3H,(H2,9,10,11)

InChI key: InChIKey=CEOXJYKPISGISK-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C1=CC(I)=C(Cl)C=C1

Synonyms:

• Benzenesulfonamide, 4-chloro-3-iodo-
• 4-Chloro-3-iodobenzenesulfonamide