CAS 1261868-03-4

Methyl 7-(chloromethyl)-2-naphthalenecarboxylate

Description:

Methyl 7-(chloromethyl)-2-naphthalenecarboxylate is an organic compound characterized by its naphthalene structure, which features a carboxylate functional group and a chloromethyl substituent. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water due to its hydrophobic naphthalene backbone. The presence of the chloromethyl group makes it a potential electrophile, allowing for further chemical reactions, such as nucleophilic substitution. This compound may be used in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to its reactive functional groups. Safety data indicates that, like many chlorinated compounds, it should be handled with care, as it may pose health risks upon exposure. Proper storage in a cool, dry place away from light is recommended to maintain its stability and integrity.

Formula: C₁₃H₁₁ClO₂

InChI: InChI=1S/C13H11ClO2/c1-16-13(15)11-5-4-10-3-2-9(8-14)6-12(10)7-11/h2-7H,8H2,1H3

InChI key: InChIKey=HDHMVLURYXEAMQ-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=CC2=C(C=C1)C=CC(CCl)=C2

Synonyms:

• Methyl 7-(chloromethyl)-2-naphthalenecarboxylate
• 2-Naphthalenecarboxylic acid, 7-(chloromethyl)-, methyl ester