CAS 126187-25-5

ETHYL 2,3,4,6-TETRA-O-ACETYL-A-D-THIOGALACTOPYRANOSIDE

Description:

Ethyl 2,3,4,6-tetra-O-acetyl-α-D-thiogalactopyranoside is a synthetic carbohydrate derivative, specifically a thio-glycoside, which is characterized by the presence of a thiol group in its structure. This compound features a galactopyranose sugar moiety that is fully acetylated at the hydroxyl groups, enhancing its stability and solubility in organic solvents. The ethyl group contributes to its overall hydrophobic character, making it useful in various chemical reactions and applications, particularly in glycosylation processes. The acetyl groups serve to protect the hydroxyl functionalities, allowing for selective reactions at specific positions on the sugar ring. This compound is often utilized in carbohydrate chemistry and biochemistry for the synthesis of more complex glycosides and can serve as a building block in the development of glycoproteins or other glyconjugates. Its unique structural features make it valuable in research related to carbohydrate interactions, enzyme substrates, and potential therapeutic applications.

Formula: C₁₆H₂₄O₉S

InChI: InChI=1/C16H24O9S/c1-6-26-16-15(24-11(5)20)14(23-10(4)19)13(22-9(3)18)12(25-16)7-21-8(2)17/h12-16H,6-7H2,1-5H3

SMILES: CCSC1C(C(C(C(COC(=O)C)O1)OC(=O)C)OC(=O)C)OC(=O)C

Synonyms:

• Ethyl 2,3,4,6-Tetra-O-Acetyl-Alpha-D-Thiogalactopyranoside
• Ethyl 2,3,4,6-Tetra-O-Acetyl-Ss-D-Thiogalactopyranoside
• ethyl 2,3,4,6-tetra-O-acetyl-1-thiohexopyranoside
• ethyl 2,3,4-tri-O-acetyl-1-thio-D-galactopyranoside
• Ethyl 2,3,4,6-Tetra-O-acetyl-α-D-thiogalactopyranoside

Ethyl 2,3,4,6-tetra-o-acetyl-a-d-thiogalactopyranoside

CAS: 126187-25-5

Formula: C₁₆H₂₄O₉S

Purity: 97%

Color and Shape: Solid

Molecular weight: 392.4214

Ref: IN-DA000S2S

Ethyl 2,3,4,6-Tetra-O-acetyl-α-D-thiogalactopyranoside

CAS: 126187-25-5

Molecular weight: 392.41

Ref: 7W-GC3717

Ethyl 2,3,4,6-tetra-O-acetyl-a-D-thiogalactopyranoside

CAS: 126187-25-5

Ethyl 2,3,4,6-tetra-O-acetyl-a-D-thiogalactopyranoside is a compound that belongs to the group of natural products. It has been shown to be an inhibitor of retrotransposons and retroviruses. This effect may be due to its ability to inhibit the enzymatic activity of reverse transcriptase, which is needed for the synthesis of viral RNA. The compound also inhibits stoloniferum, a plant pathogen that causes phytophthora root rot. Ethyl 2,3,4,6-tetra-O-acetyl-a-D-thiogalactopyranoside can induce epigenetic modifications in human malignant cells and may have potential as a chemotherapeutic agent for malignant melanoma cells.

Formula: C₁₆H₂₄O₉S

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 392.42 g/mol

Ref: 3D-ME04951