CAS 1261883-36-6

7-(Trifluoromethoxy)-2-naphthalenamine

Description:

7-(Trifluoromethoxy)-2-naphthalenamine is an organic compound characterized by its naphthalene structure substituted with a trifluoromethoxy group and an amino group. The presence of the trifluoromethoxy group significantly influences its chemical properties, imparting high electronegativity and lipophilicity, which can enhance its reactivity and solubility in organic solvents. The amino group contributes to its potential as a nucleophile, allowing for various chemical reactions, including substitution and coupling reactions. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for pharmaceutical applications. Additionally, the trifluoromethoxy group can enhance the compound's stability and metabolic resistance, which is valuable in drug design. Its molecular interactions, such as hydrogen bonding and π-π stacking, can also play a role in its behavior in biological systems. Overall, 7-(Trifluoromethoxy)-2-naphthalenamine is a compound of interest in both synthetic organic chemistry and medicinal chemistry due to its unique structural characteristics and potential applications.

Formula: C₁₁H₈F₃NO

InChI: InChI=1S/C11H8F3NO/c12-11(13,14)16-10-4-2-7-1-3-9(15)5-8(7)6-10/h1-6H,15H2

InChI key: InChIKey=YOTFZXQUXRNTIP-UHFFFAOYSA-N

SMILES: O(C(F)(F)F)C1=CC2=C(C=C1)C=CC(N)=C2

Synonyms:

• 7-(Trifluoromethoxy)-2-naphthalenamine
• 2-Naphthalenamine, 7-(trifluoromethoxy)-