CymitQuimica logo

CAS 1261885-66-8

:

ethyl 1H-pyrrolo[3,2-b]pyridine-6-carboxylate

Description:
Ethyl 1H-pyrrolo[3,2-b]pyridine-6-carboxylate is a heterocyclic organic compound characterized by its pyrrole and pyridine ring structures, which contribute to its unique chemical properties. This compound typically appears as a solid or liquid, depending on its specific formulation and purity. It features a carboxylate functional group, which enhances its reactivity and solubility in various solvents. The presence of the ethyl ester group suggests that it may participate in esterification and hydrolysis reactions. Ethyl 1H-pyrrolo[3,2-b]pyridine-6-carboxylate is of interest in medicinal chemistry due to its potential biological activities, including antimicrobial and anticancer properties. Its molecular structure allows for various substitutions, which can lead to the development of derivatives with enhanced pharmacological profiles. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, this compound represents a valuable scaffold for further research and development in chemical and pharmaceutical applications.
Formula:C10H10N2O2
InChI:InChI=1S/C10H10N2O2/c1-2-14-10(13)7-5-9-8(12-6-7)3-4-11-9/h3-6,11H,2H2,1H3
InChI key:NAJRZBFAOZOKDX-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=CC2=C(C=CN2)N=C1
Found 4 products.