CAS 1261887-90-4
:2-Fluoro-3′-(trifluoromethyl)[1,1′-biphenyl]-4-carboxamide
Description:
2-Fluoro-3′-(trifluoromethyl)[1,1′-biphenyl]-4-carboxamide is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the second position and a trifluoromethyl group at the third position of the biphenyl moiety significantly influences its chemical properties, including its reactivity and polarity. The carboxamide functional group at the fourth position contributes to its potential as a hydrogen bond donor and acceptor, enhancing its solubility in polar solvents. This compound may exhibit interesting biological activities due to its unique structural features, making it a subject of interest in medicinal chemistry and material science. Additionally, the presence of multiple fluorine atoms typically increases the compound's stability and lipophilicity, which can affect its pharmacokinetic properties. Overall, 2-Fluoro-3′-(trifluoromethyl)[1,1′-biphenyl]-4-carboxamide is a fluorinated organic compound with potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C14H9F4NO
InChI:InChI=1S/C14H9F4NO/c15-12-7-9(13(19)20)4-5-11(12)8-2-1-3-10(6-8)14(16,17)18/h1-7H,(H2,19,20)
InChI key:InChIKey=DOTINRZXHIYJNS-UHFFFAOYSA-N
SMILES:FC1=C(C2=CC(C(F)(F)F)=CC=C2)C=CC(C(N)=O)=C1
Synonyms:- 2-Fluoro-3′-(trifluoromethyl)[1,1′-biphenyl]-4-carboxamide
- [1,1′-Biphenyl]-4-carboxamide, 2-fluoro-3′-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.