CymitQuimica logo

CAS 1261888-29-2

:

3′-Methoxy-5-methyl[1,1′-biphenyl]-3-ol

Description:
3′-Methoxy-5-methyl[1,1′-biphenyl]-3-ol, identified by its CAS number 1261888-29-2, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a methoxy group (-OCH3) and a hydroxyl group (-OH) attached to the biphenyl framework, contributing to its chemical reactivity and potential applications. The presence of the methyl group at the 5-position of the biphenyl enhances its hydrophobic characteristics, while the hydroxyl group provides polar properties, making it soluble in certain solvents. The methoxy group can influence the compound's electronic properties, potentially affecting its reactivity and interactions with other molecules. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its unique structural features and potential biological activities. As with many organic compounds, its stability, reactivity, and interactions can be influenced by environmental factors such as temperature and pH.
Formula:C14H14O2
InChI:InChI=1S/C14H14O2/c1-10-6-12(8-13(15)7-10)11-4-3-5-14(9-11)16-2/h3-9,15H,1-2H3
InChI key:InChIKey=SFMWBNCWNDKTSL-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C=CC1)C2=CC(C)=CC(O)=C2
Synonyms:
  • 3′-Methoxy-5-methyl[1,1′-biphenyl]-3-ol
  • [1,1′-Biphenyl]-3-ol, 3′-methoxy-5-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.