
CAS 1261888-32-7
:1-(4′-Hydroxy-3′-methyl[1,1′-biphenyl]-4-yl)ethanone
Description:
1-(4′-Hydroxy-3′-methyl[1,1′-biphenyl]-4-yl)ethanone, also known by its CAS number 1261888-32-7, is an organic compound characterized by its biphenyl structure, which features a hydroxyl group and a methyl group on one of the phenyl rings. This compound typically exhibits properties associated with phenolic compounds, including potential antioxidant activity due to the presence of the hydroxyl group. The ketone functional group (ethanone) contributes to its reactivity, allowing for various chemical transformations. It may be soluble in organic solvents and exhibit moderate polarity, influencing its interactions in biological systems. The compound's structural features suggest potential applications in pharmaceuticals, materials science, or as a chemical intermediate. Its specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values. Overall, this compound represents a unique combination of functional groups that may impart interesting chemical and biological properties.
Formula:C15H14O2
InChI:InChI=1S/C15H14O2/c1-10-9-14(7-8-15(10)17)13-5-3-12(4-6-13)11(2)16/h3-9,17H,1-2H3
InChI key:InChIKey=DGVNTRGLRMRXNY-UHFFFAOYSA-N
SMILES:CC=1C=C(C=CC1O)C2=CC=C(C(C)=O)C=C2
Synonyms:- Ethanone, 1-(4′-hydroxy-3′-methyl[1,1′-biphenyl]-4-yl)-
- 1-(4′-Hydroxy-3′-methyl[1,1′-biphenyl]-4-yl)ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.