CymitQuimica logo

CAS 1261888-42-9

:

2′,4-Dichloro-5′-methoxy[1,1′-biphenyl]-3-ol

Description:
2′,4-Dichloro-5′-methoxy[1,1′-biphenyl]-3-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features two chlorine atoms and a methoxy group attached to the biphenyl framework, contributing to its unique chemical properties. The presence of hydroxyl (-OH) and methoxy (-OCH₃) functional groups indicates potential for hydrogen bonding and influences its solubility in various solvents. The dichloro substitution pattern suggests that it may exhibit specific reactivity and biological activity, potentially making it relevant in fields such as agrochemicals or pharmaceuticals. Its molecular structure allows for various interactions, including hydrophobic and polar interactions, which can affect its behavior in biological systems. Additionally, the compound's stability and reactivity can be influenced by environmental factors, making it important to consider in applications involving chemical safety and environmental impact. Overall, 2′,4-Dichloro-5′-methoxy[1,1′-biphenyl]-3-ol represents a complex chemical entity with diverse potential applications.
Formula:C13H10Cl2O2
InChI:InChI=1S/C13H10Cl2O2/c1-17-9-3-5-11(14)10(7-9)8-2-4-12(15)13(16)6-8/h2-7,16H,1H3
InChI key:InChIKey=DHHCUVVZNXKBBZ-UHFFFAOYSA-N
SMILES:ClC=1C(=CC(OC)=CC1)C2=CC(O)=C(Cl)C=C2
Synonyms:
  • [1,1′-Biphenyl]-3-ol, 2′,4-dichloro-5′-methoxy-
  • 2′,4-Dichloro-5′-methoxy[1,1′-biphenyl]-3-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.