
CAS 1261888-49-6
:4′-Chloro-3′-hydroxy[1,1′-biphenyl]-3,5-dicarboxylic acid
Description:
4′-Chloro-3′-hydroxy[1,1′-biphenyl]-3,5-dicarboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a chloro group and a hydroxy group on the biphenyl moiety, contributing to its chemical reactivity and potential applications in various fields. The presence of two carboxylic acid groups at the 3 and 5 positions enhances its acidity and solubility in polar solvents, making it useful in organic synthesis and as a potential intermediate in the production of pharmaceuticals or agrochemicals. The chlorine substituent may also influence its biological activity and interaction with other chemical species. Overall, this compound's unique functional groups and structural characteristics make it a subject of interest in both research and industrial applications, particularly in the development of new materials or biologically active compounds.
Formula:C14H9ClO5
InChI:InChI=1S/C14H9ClO5/c15-11-2-1-7(6-12(11)16)8-3-9(13(17)18)5-10(4-8)14(19)20/h1-6,16H,(H,17,18)(H,19,20)
InChI key:InChIKey=FHIKYRZCWZFFOQ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=C(C(O)=O)C1)C2=CC(O)=C(Cl)C=C2
Synonyms:- 4′-Chloro-3′-hydroxy[1,1′-biphenyl]-3,5-dicarboxylic acid
- [1,1′-Biphenyl]-3,5-dicarboxylic acid, 4′-chloro-3′-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.