
CAS 1261888-51-0
:N-(3′-Chloro-5′-hydroxy[1,1′-biphenyl]-3-yl)methanesulfonamide
Description:
N-(3′-Chloro-5′-hydroxy[1,1′-biphenyl]-3-yl)methanesulfonamide is a chemical compound characterized by its biphenyl structure, which features a chlorine atom and a hydroxyl group on the aromatic ring. The presence of the methanesulfonamide functional group indicates that it possesses sulfonamide characteristics, which can influence its solubility and reactivity. This compound may exhibit biological activity, potentially serving as a pharmaceutical agent or a research chemical, given the structural motifs that are often associated with medicinal properties. Its molecular structure suggests it could engage in hydrogen bonding due to the hydroxyl group, while the chlorine substituent may affect its electronic properties and steric hindrance. The sulfonamide group is known for its role in various biological processes, including antibacterial activity. Overall, the compound's unique combination of functional groups and structural features may contribute to its potential applications in medicinal chemistry and material science.
Formula:C13H12ClNO3S
InChI:InChI=1S/C13H12ClNO3S/c1-19(17,18)15-12-4-2-3-9(6-12)10-5-11(14)8-13(16)7-10/h2-8,15-16H,1H3
InChI key:InChIKey=LUISYTYHWUBEOB-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=C(O)C1)C2=CC(NS(C)(=O)=O)=CC=C2
Synonyms:- N-(3′-Chloro-5′-hydroxy[1,1′-biphenyl]-3-yl)methanesulfonamide
- Methanesulfonamide, N-(3′-chloro-5′-hydroxy[1,1′-biphenyl]-3-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.