CAS 1261889-07-9

4′-Methyl-5-(trifluoromethyl)[1,1′-biphenyl]-3-ol

Description:

4′-Methyl-5-(trifluoromethyl)[1,1′-biphenyl]-3-ol, identified by its CAS number 1261889-07-9, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a hydroxyl group (-OH) at the 3-position contributes to its classification as a phenolic compound, influencing its reactivity and solubility in polar solvents. The trifluoromethyl group (-CF3) at the 5-position significantly enhances the compound's lipophilicity and may affect its electronic properties, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. The methyl group at the 4′ position can also influence the compound's steric and electronic characteristics. Overall, this compound exhibits unique properties due to the combination of its functional groups and structural features, which can be leveraged in synthetic chemistry and material science. Its specific interactions and behavior in different environments would depend on factors such as pH, temperature, and the presence of other chemical species.

Formula: C₁₄H₁₁F₃O

InChI: InChI=1S/C14H11F3O/c1-9-2-4-10(5-3-9)11-6-12(14(15,16)17)8-13(18)7-11/h2-8,18H,1H3

InChI key: InChIKey=TXOMDBKLZDENAI-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C(C=C(O)C1)C2=CC=C(C)C=C2

Synonyms:

• [1,1′-Biphenyl]-3-ol, 4′-methyl-5-(trifluoromethyl)-
• 4′-Methyl-5-(trifluoromethyl)[1,1′-biphenyl]-3-ol